C13H15NOS2 — CID 43793990
6-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-one (PubChem CID 43793990) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-one.
| Compound Name | 6-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-one |
|---|---|
| PubChem CID | 43793990 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-one |
| SMILES | CC(=O)CCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15NOS2/c1-10(15)6-4-5-9-16-13-14-11-7-2-3-8-12(11)17-13/h2-3,7-8H,4-6,9H2,1H3 |
| InChIKey | SOTMIOJSPNGPIY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|