C13H15NO2S2 — CID 71381702
2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylpropanoate (PubChem CID 71381702) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylpropanoate.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 71381702 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15NO2S2/c1-9(2)12(15)16-7-8-17-13-14-10-5-3-4-6-11(10)18-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | HSKKEICZEZGVRB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|