C15H20N2O2S2 — CID 63033579
methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-2-(propylamino)butanoate (PubChem CID 63033579) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-2-(propylamino)butanoate.
| Compound Name | methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-2-(propylamino)butanoate |
|---|---|
| PubChem CID | 63033579 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-2-(propylamino)butanoate |
| SMILES | CCCNC(CCSc1nc2ccccc2s1)C(=O)OC |
| InChI | InChI=1S/C15H20N2O2S2/c1-3-9-16-12(14(18)19-2)8-10-20-15-17-11-6-4-5-7-13(11)21-15/h4-7,12,16H,3,8-10H2,1-2H3 |
| InChIKey | HJKLFRMVCWOSCK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |