C14H17NO2S2 — CID 59245507
2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylbutanoate (PubChem CID 59245507) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylbutanoate.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59245507 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17NO2S2/c1-3-10(2)13(16)17-8-9-18-14-15-11-6-4-5-7-12(11)19-14/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | ZAFFPDSSQXLBNW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|