C11H12N2OS2 — CID 15005944
3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylpropanamide (PubChem CID 15005944) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylpropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 15005944 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylpropanamide |
| SMILES | CNC(=O)CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H12N2OS2/c1-12-10(14)6-7-15-11-13-8-4-2-3-5-9(8)16-11/h2-5H,6-7H2,1H3,(H,12,14) |
| InChIKey | FZZJRXOPEOSEKB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |