C16H22N2OS2 — CID 2109065
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methylbutan-2-yl)butanamide (PubChem CID 2109065) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methylbutan-2-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 2109065 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methylbutan-2-yl)butanamide |
| SMILES | CCC(C)(C)NC(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H22N2OS2/c1-4-16(2,3)18-14(19)10-7-11-20-15-17-12-8-5-6-9-13(12)21-15/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | WZMDGWQCOANOEW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|