C18H22N4OS3 — CID 16551046
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 16551046) has the molecular formula C18H22N4OS3 and a molecular weight of 406.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 16551046 |
| Molecular Formula | C18H22N4OS3 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCCCCc1nnc(NC(=O)CCCSc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C18H22N4OS3/c1-2-3-4-11-16-21-22-17(26-16)20-15(23)10-7-12-24-18-19-13-8-5-6-9-14(13)25-18/h5-6,8-9H,2-4,7,10-12H2,1H3,(H,20,22,23) |
| InChIKey | AIMCWMFBCVLMDD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|