C19H21N3OS4 — CID 22592228
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]butanamide (PubChem CID 22592228) has the molecular formula C19H21N3OS4 and a molecular weight of 435.67 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 22592228 |
| Molecular Formula | C19H21N3OS4 |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]butanamide |
| SMILES | CSc1cc(C)nc(SC)c1NC(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H21N3OS4/c1-12-11-15(24-2)17(18(20-12)25-3)22-16(23)9-6-10-26-19-21-13-7-4-5-8-14(13)27-19/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,22,23) |
| InChIKey | VOQQRWAJHWAAET-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|