C25H22N4OS2 — CID 16559405
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)butanamide (PubChem CID 16559405) has the molecular formula C25H22N4OS2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)butanamide |
|---|---|
| PubChem CID | 16559405 |
| Molecular Formula | C25H22N4OS2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)butanamide |
| SMILES | Cc1ccc2nc(-c3ccccc3)c(NC(=O)CCCSc3nc4ccccc4s3)n2c1 |
| InChI | InChI=1S/C25H22N4OS2/c1-17-13-14-21-27-23(18-8-3-2-4-9-18)24(29(21)16-17)28-22(30)12-7-15-31-25-26-19-10-5-6-11-20(19)32-25/h2-6,8-11,13-14,16H,7,12,15H2,1H3,(H,28,30) |
| InChIKey | CCHQSGFUVUQWGU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|