C22H18N4O4 — CID 18225194
N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-2-(4-nitrophenoxy)acetamide (PubChem CID 18225194) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 18225194 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-2-(4-nitrophenoxy)acetamide |
| SMILES | Cc1ccc2nc(-c3ccccc3)c(NC(=O)COc3ccc([N+](=O)[O-])cc3)n2c1 |
| InChI | InChI=1S/C22H18N4O4/c1-15-7-12-19-23-21(16-5-3-2-4-6-16)22(25(19)13-15)24-20(27)14-30-18-10-8-17(9-11-18)26(28)29/h2-13H,14H2,1H3,(H,24,27) |
| InChIKey | CGWLLYNLZYMTOE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|