C19H18N4O3S2 — CID 2523524
5-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzene-1,3-dicarboxamide (PubChem CID 2523524) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2523524 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NC(=O)CCCSc2nc3ccccc3s2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C19H18N4O3S2/c20-17(25)11-8-12(18(21)26)10-13(9-11)22-16(24)6-3-7-27-19-23-14-4-1-2-5-15(14)28-19/h1-2,4-5,8-10H,3,6-7H2,(H2,20,25)(H2,21,26)(H,22,24) |
| InChIKey | SHYLEFUJEVUXOH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|