C16H16N4OS3 — CID 2161612
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 2161612) has the molecular formula C16H16N4OS3 and a molecular weight of 376.53 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2161612 |
| Molecular Formula | C16H16N4OS3 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C16H16N4OS3/c21-13(18-15-20-19-14(24-15)10-7-8-10)6-3-9-22-16-17-11-4-1-2-5-12(11)23-16/h1-2,4-5,10H,3,6-9H2,(H,18,20,21) |
| InChIKey | LFHCWUACHVFBAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|