C15H18N2O3S3 — CID 17426021
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(1,1-dioxothiolan-3-yl)butanamide (PubChem CID 17426021) has the molecular formula C15H18N2O3S3 and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(1,1-dioxothiolan-3-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(1,1-dioxothiolan-3-yl)butanamide |
|---|---|
| PubChem CID | 17426021 |
| Molecular Formula | C15H18N2O3S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(1,1-dioxothiolan-3-yl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O3S3/c18-14(16-11-7-9-23(19,20)10-11)6-3-8-21-15-17-12-4-1-2-5-13(12)22-15/h1-2,4-5,11H,3,6-10H2,(H,16,18) |
| InChIKey | BYRFKNUERCGMJC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|