C27H23N3O4S3 — CID 6518543
N-[(Z)-1-(1,3-benzothiazol-2-ylsulfanyl)-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 6518543) has the molecular formula C27H23N3O4S3 and a molecular weight of 549.70 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzothiazol-2-ylsulfanyl)-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1,3-benzothiazol-2-ylsulfanyl)-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6518543 |
| Molecular Formula | C27H23N3O4S3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | N-[(Z)-1-(1,3-benzothiazol-2-ylsulfanyl)-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)/C(NC(=O)c1ccccc1)=C(/Sc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O4S3/c31-25(19-11-5-2-6-12-19)30-23(26(32)28-20-15-16-37(33,34)17-20)24(18-9-3-1-4-10-18)36-27-29-21-13-7-8-14-22(21)35-27/h1-14,20H,15-17H2,(H,28,32)(H,30,31)/b24-23- |
| InChIKey | UXPITXKTJIJSKD-VHXPQNKSSA-N |
| XLogP | 4.49 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|