C28H25N3O2S2 — CID 3767308
N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]benzamide (PubChem CID 3767308) has the molecular formula C28H25N3O2S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3767308 |
| Molecular Formula | C28H25N3O2S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NC(C(=O)N1CCCCC1)=C(Sc1nc2ccccc2s1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25N3O2S2/c32-26(21-14-6-2-7-15-21)30-24(27(33)31-18-10-3-11-19-31)25(20-12-4-1-5-13-20)35-28-29-22-16-8-9-17-23(22)34-28/h1-2,4-9,12-17H,3,10-11,18-19H2,(H,30,32) |
| InChIKey | NKMGDKLSQOBPEO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|