C12H11NO3S2 — CID 57312228
methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate (PubChem CID 57312228) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate.
| Compound Name | methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 57312228 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-ylsulfanyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H11NO3S2/c1-16-10(14)6-7-11(15)18-12-13-8-4-2-3-5-9(8)17-12/h2-5H,6-7H2,1H3 |
| InChIKey | CEVAPEQFMKWMSN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|