C18H18N2OS2 — CID 71422321
S-(1,3-benzothiazol-2-yl) 3-(benzylamino)butanethioate (PubChem CID 71422321) has the molecular formula C18H18N2OS2 and a molecular weight of 342.49 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 3-(benzylamino)butanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 3-(benzylamino)butanethioate |
|---|---|
| PubChem CID | 71422321 |
| Molecular Formula | C18H18N2OS2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 3-(benzylamino)butanethioate |
| SMILES | CC(CC(=O)Sc1nc2ccccc2s1)NCc1ccccc1 |
| InChI | InChI=1S/C18H18N2OS2/c1-13(19-12-14-7-3-2-4-8-14)11-17(21)23-18-20-15-9-5-6-10-16(15)22-18/h2-10,13,19H,11-12H2,1H3 |
| InChIKey | KMRNNCWQUDFWGC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|