C9H8N2OS2 — CID 45077506
N-(1,3-benzothiazol-2-ylsulfanyl)acetamide (PubChem CID 45077506) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 45077506 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
| SMILES | CC(=O)NSc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8N2OS2/c1-6(12)11-14-9-10-7-4-2-3-5-8(7)13-9/h2-5H,1H3,(H,11,12) |
| InChIKey | CPMGCOQDXXAFCB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|