C12H12N2O3S3 — CID 597356
2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoic acid (PubChem CID 597356) has the molecular formula C12H12N2O3S3 and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 597356 |
| Molecular Formula | C12H12N2O3S3 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoic acid |
| SMILES | CC(=O)NC(CSSc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H12N2O3S3/c1-7(15)13-9(11(16)17)6-18-20-12-14-8-4-2-3-5-10(8)19-12/h2-5,9H,6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | SIBOONQDJCKTOO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|