C12H13NS4 — CID 137470114
2-[[(E)-2-methylbut-2-enyl]trisulfanyl]-1,3-benzothiazole (PubChem CID 137470114) has the molecular formula C12H13NS4 and a molecular weight of 299.51 g/mol. Its IUPAC name is 2-[[(E)-2-methylbut-2-enyl]trisulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[(E)-2-methylbut-2-enyl]trisulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 137470114 |
| Molecular Formula | C12H13NS4 |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-[[(E)-2-methylbut-2-enyl]trisulfanyl]-1,3-benzothiazole |
| SMILES | C/C=C(\C)CSSSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NS4/c1-3-9(2)8-14-17-16-12-13-10-6-4-5-7-11(10)15-12/h3-7H,8H2,1-2H3/b9-3+ |
| InChIKey | NASJKDHYHFXLIC-YCRREMRBSA-N |
| XLogP | 5.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|