C12H13NS3 — CID 59008381
2-(pent-1-en-3-yldisulfanyl)-1,3-benzothiazole (PubChem CID 59008381) has the molecular formula C12H13NS3 and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-(pent-1-en-3-yldisulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(pent-1-en-3-yldisulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 59008381 |
| Molecular Formula | C12H13NS3 |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-(pent-1-en-3-yldisulfanyl)-1,3-benzothiazole |
| SMILES | C=CC(CC)SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NS3/c1-3-9(4-2)15-16-12-13-10-7-5-6-8-11(10)14-12/h3,5-9H,1,4H2,2H3 |
| InChIKey | NMYCLRALTLURRX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|