C13H15NS3 — CID 13131245
2-(4-methylpent-3-en-2-yldisulfanyl)-1,3-benzothiazole (PubChem CID 13131245) has the molecular formula C13H15NS3 and a molecular weight of 281.47 g/mol. Its IUPAC name is 2-(4-methylpent-3-en-2-yldisulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(4-methylpent-3-en-2-yldisulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 13131245 |
| Molecular Formula | C13H15NS3 |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-(4-methylpent-3-en-2-yldisulfanyl)-1,3-benzothiazole |
| SMILES | CC(C)=CC(C)SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15NS3/c1-9(2)8-10(3)16-17-13-14-11-6-4-5-7-12(11)15-13/h4-8,10H,1-3H3 |
| InChIKey | BYCTUGVNAQTWKY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|