C17H21NS2 — CID 71325442
2-(2,6-dimethylocta-2,6-dien-4-ylsulfanyl)-1,3-benzothiazole (PubChem CID 71325442) has the molecular formula C17H21NS2 and a molecular weight of 303.50 g/mol. Its IUPAC name is 2-(2,6-dimethylocta-2,6-dien-4-ylsulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(2,6-dimethylocta-2,6-dien-4-ylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 71325442 |
| Molecular Formula | C17H21NS2 |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(2,6-dimethylocta-2,6-dien-4-ylsulfanyl)-1,3-benzothiazole |
| SMILES | CC=C(C)CC(C=C(C)C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H21NS2/c1-5-13(4)11-14(10-12(2)3)19-17-18-15-8-6-7-9-16(15)20-17/h5-10,14H,11H2,1-4H3 |
| InChIKey | ZQHKFBGBHVWOSI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|