C17H17NOS2 — CID 122379582
2-(1-phenylmethoxypropan-2-ylsulfanyl)-1,3-benzothiazole (PubChem CID 122379582) has the molecular formula C17H17NOS2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-(1-phenylmethoxypropan-2-ylsulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(1-phenylmethoxypropan-2-ylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 122379582 |
| Molecular Formula | C17H17NOS2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(1-phenylmethoxypropan-2-ylsulfanyl)-1,3-benzothiazole |
| SMILES | CC(COCc1ccccc1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H17NOS2/c1-13(11-19-12-14-7-3-2-4-8-14)20-17-18-15-9-5-6-10-16(15)21-17/h2-10,13H,11-12H2,1H3 |
| InChIKey | KQEZBBOOCXUXQR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |