C25H25NO5S2 — CID 46206407
3-(1,3-benzothiazol-2-ylsulfonyl)-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 46206407) has the molecular formula C25H25NO5S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfonyl)-1,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfonyl)-1,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 46206407 |
| Molecular Formula | C25H25NO5S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfonyl)-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | O=S(=O)(c1nc2ccccc2s1)C(COCc1ccccc1)C(O)COCc1ccccc1 |
| InChI | InChI=1S/C25H25NO5S2/c27-22(17-30-15-19-9-3-1-4-10-19)24(18-31-16-20-11-5-2-6-12-20)33(28,29)25-26-21-13-7-8-14-23(21)32-25/h1-14,22,24,27H,15-18H2 |
| InChIKey | DBBNMTLXSIJGDI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |