C11H12FNO2S2 — CID 44605360
2-(1-fluorobutylsulfonyl)-1,3-benzothiazole (PubChem CID 44605360) has the molecular formula C11H12FNO2S2 and a molecular weight of 273.35 g/mol. Its IUPAC name is 2-(1-fluorobutylsulfonyl)-1,3-benzothiazole.
| Compound Name | 2-(1-fluorobutylsulfonyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 44605360 |
| Molecular Formula | C11H12FNO2S2 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(1-fluorobutylsulfonyl)-1,3-benzothiazole |
| SMILES | CCCC(F)S(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H12FNO2S2/c1-2-5-10(12)17(14,15)11-13-8-6-3-4-7-9(8)16-11/h3-4,6-7,10H,2,5H2,1H3 |
| InChIKey | ASFUAHNSVXSBPC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |