C26H41NO5S2 — CID 46206080
methyl 10-(1,3-benzothiazol-2-ylsulfonyl)-9-hydroxyoctadecanoate (PubChem CID 46206080) has the molecular formula C26H41NO5S2 and a molecular weight of 511.75 g/mol. Its IUPAC name is methyl 10-(1,3-benzothiazol-2-ylsulfonyl)-9-hydroxyoctadecanoate.
| Compound Name | methyl 10-(1,3-benzothiazol-2-ylsulfonyl)-9-hydroxyoctadecanoate |
|---|---|
| PubChem CID | 46206080 |
| Molecular Formula | C26H41NO5S2 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | methyl 10-(1,3-benzothiazol-2-ylsulfonyl)-9-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(C(O)CCCCCCCC(=O)OC)S(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H41NO5S2/c1-3-4-5-6-9-12-19-24(22(28)17-11-8-7-10-13-20-25(29)32-2)34(30,31)26-27-21-16-14-15-18-23(21)33-26/h14-16,18,22,24,28H,3-13,17,19-20H2,1-2H3 |
| InChIKey | OOGLEVBHQKNVOD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|