C12H13NO4S2 — CID 101477114
methyl (2R)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropanoate (PubChem CID 101477114) has the molecular formula C12H13NO4S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (2R)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropanoate.
| Compound Name | methyl (2R)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 101477114 |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | methyl (2R)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NO4S2/c1-8(11(14)17-2)7-19(15,16)12-13-9-5-3-4-6-10(9)18-12/h3-6,8H,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | YEJHVQNEWQWWRH-QMMMGPOBSA-N |
| XLogP | 1.88 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |