C9H11N3O3S2 — CID 19894858
N-(2-amino-2-hydroxyethyl)-1,3-benzothiazole-2-sulfonamide (PubChem CID 19894858) has the molecular formula C9H11N3O3S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyethyl)-1,3-benzothiazole-2-sulfonamide.
| Compound Name | N-(2-amino-2-hydroxyethyl)-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 19894858 |
| Molecular Formula | C9H11N3O3S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | N-(2-amino-2-hydroxyethyl)-1,3-benzothiazole-2-sulfonamide |
| SMILES | NC(O)CNS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C9H11N3O3S2/c10-8(13)5-11-17(14,15)9-12-6-3-1-2-4-7(6)16-9/h1-4,8,11,13H,5,10H2 |
| InChIKey | GDKDQRNMVQOKTP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|