C7H8N2O2P2S2 — CID 59552462
N-(diphosphanyl)-1,3-benzothiazole-2-sulfonamide (PubChem CID 59552462) has the molecular formula C7H8N2O2P2S2 and a molecular weight of 278.24 g/mol. Its IUPAC name is N-(diphosphanyl)-1,3-benzothiazole-2-sulfonamide.
| Compound Name | N-(diphosphanyl)-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 59552462 |
| Molecular Formula | C7H8N2O2P2S2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | N-(diphosphanyl)-1,3-benzothiazole-2-sulfonamide |
| SMILES | O=S(=O)(NPP)c1nc2ccccc2s1 |
| InChI | InChI=1S/C7H8N2O2P2S2/c10-15(11,9-13-12)7-8-5-3-1-2-4-6(5)14-7/h1-4,9,13H,12H2 |
| InChIKey | JHZVGFTZDSWRSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|