C15H11NO4S3 — CID 155105423
2-[(Z)-2-(benzenesulfonyl)ethenyl]sulfonyl-1,3-benzothiazole (PubChem CID 155105423) has the molecular formula C15H11NO4S3 and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[(Z)-2-(benzenesulfonyl)ethenyl]sulfonyl-1,3-benzothiazole.
| Compound Name | 2-[(Z)-2-(benzenesulfonyl)ethenyl]sulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 155105423 |
| Molecular Formula | C15H11NO4S3 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-[(Z)-2-(benzenesulfonyl)ethenyl]sulfonyl-1,3-benzothiazole |
| SMILES | O=S(=O)(/C=C\S(=O)(=O)c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO4S3/c17-22(18,12-6-2-1-3-7-12)10-11-23(19,20)15-16-13-8-4-5-9-14(13)21-15/h1-11H/b11-10- |
| InChIKey | REIVCZGGVOOADB-KHPPLWFESA-N |
| XLogP | 3.02 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |