C12H13NO2S2 — CID 101459308
2-cyclopentylsulfonyl-1,3-benzothiazole (PubChem CID 101459308) has the molecular formula C12H13NO2S2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-1,3-benzothiazole.
| Compound Name | 2-cyclopentylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 101459308 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-cyclopentylsulfonyl-1,3-benzothiazole |
| SMILES | O=S(=O)(c1nc2ccccc2s1)C1CCCC1 |
| InChI | InChI=1S/C12H13NO2S2/c14-17(15,9-5-1-2-6-9)12-13-10-7-3-4-8-11(10)16-12/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | YUZIETZPJNKQCV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |