C11H14ClN3O2S2 — CID 71645864
2-piperazin-1-ylsulfonyl-1,3-benzothiazole;hydrochloride (PubChem CID 71645864) has the molecular formula C11H14ClN3O2S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-piperazin-1-ylsulfonyl-1,3-benzothiazole;hydrochloride.
| Compound Name | 2-piperazin-1-ylsulfonyl-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 71645864 |
| Molecular Formula | C11H14ClN3O2S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-piperazin-1-ylsulfonyl-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1nc2ccccc2s1)N1CCNCC1 |
| InChI | InChI=1S/C11H13N3O2S2.ClH/c15-18(16,14-7-5-12-6-8-14)11-13-9-3-1-2-4-10(9)17-11;/h1-4,12H,5-8H2;1H |
| InChIKey | OAUFMVDCYAUXCX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |