C12H14N2O2S2 — CID 71645533
2-piperidin-3-ylsulfonyl-1,3-benzothiazole (PubChem CID 71645533) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-piperidin-3-ylsulfonyl-1,3-benzothiazole.
| Compound Name | 2-piperidin-3-ylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 71645533 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-piperidin-3-ylsulfonyl-1,3-benzothiazole |
| SMILES | O=S(=O)(c1nc2ccccc2s1)C1CCCNC1 |
| InChI | InChI=1S/C12H14N2O2S2/c15-18(16,9-4-3-7-13-8-9)12-14-10-5-1-2-6-11(10)17-12/h1-2,5-6,9,13H,3-4,7-8H2 |
| InChIKey | HSXPUBQBSNABJD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |