C12H14N2S — CID 2121164
2-[(3S)-piperidin-3-yl]-1,3-benzothiazole (PubChem CID 2121164) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[(3S)-piperidin-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3S)-piperidin-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2121164 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[(3S)-piperidin-3-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc([C@H]3CCCNC3)nc2c1 |
| InChI | InChI=1S/C12H14N2S/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9/h1-2,5-6,9,13H,3-4,7-8H2/t9-/m0/s1 |
| InChIKey | PXPKASSSZWCUJE-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |