C11H12N2S — CID 116999894
3-(1,3-benzothiazol-2-yl)cyclobutan-1-amine (PubChem CID 116999894) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)cyclobutan-1-amine.
| Compound Name | 3-(1,3-benzothiazol-2-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 116999894 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)cyclobutan-1-amine |
| SMILES | NC1CC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C11H12N2S/c12-8-5-7(6-8)11-13-9-3-1-2-4-10(9)14-11/h1-4,7-8H,5-6,12H2 |
| InChIKey | XWDUACKGHBUCAX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |