C10H9NOS — CID 72744188
2-(3-methyloxiran-2-yl)-1,3-benzothiazole (PubChem CID 72744188) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-(3-methyloxiran-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(3-methyloxiran-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 72744188 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-(3-methyloxiran-2-yl)-1,3-benzothiazole |
| SMILES | CC1OC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9NOS/c1-6-9(12-6)10-11-7-4-2-3-5-8(7)13-10/h2-6,9H,1H3 |
| InChIKey | WZAUCJNGCNVXIP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|