C11H12N2OS — CID 96788923
(3R)-3-(1,3-benzothiazol-2-yl)morpholine (PubChem CID 96788923) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is (3R)-3-(1,3-benzothiazol-2-yl)morpholine.
| Compound Name | (3R)-3-(1,3-benzothiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 96788923 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (3R)-3-(1,3-benzothiazol-2-yl)morpholine |
| SMILES | c1ccc2sc([C@H]3COCCN3)nc2c1 |
| InChI | InChI=1S/C11H12N2OS/c1-2-4-10-8(3-1)13-11(15-10)9-7-14-6-5-12-9/h1-4,9,12H,5-7H2/t9-/m1/s1 |
| InChIKey | HTRYLKRMWMMOGW-SECBINFHSA-N |
| XLogP | 1.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |