C15H12N2S — CID 43196878
2-(2,3-dihydro-1H-indol-2-yl)-1,3-benzothiazole (PubChem CID 43196878) has the molecular formula C15H12N2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,3-dihydro-1H-indol-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 43196878 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc2c(c1)CC(c1nc3ccccc3s1)N2 |
| InChI | InChI=1S/C15H12N2S/c1-2-6-11-10(5-1)9-13(16-11)15-17-12-7-3-4-8-14(12)18-15/h1-8,13,16H,9H2 |
| InChIKey | QNLJXHNJECJZNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |