C12H11NOS — CID 164678956
3-(1,3-benzothiazol-2-yl)cyclopentan-1-one (PubChem CID 164678956) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)cyclopentan-1-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 164678956 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)cyclopentan-1-one |
| SMILES | O=C1CCC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C12H11NOS/c14-9-6-5-8(7-9)12-13-10-3-1-2-4-11(10)15-12/h1-4,8H,5-7H2 |
| InChIKey | PEBBJWVNWPDMJR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |