C13H16N2OS2 — CID 174477252
CID 174477252 (PubChem CID 174477252) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol.
| Compound Name | CID 174477252 |
|---|---|
| PubChem CID | 174477252 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | — |
| SMILES | N=S=O.c1ccc2sc(C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H15NS.HNOS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;1-3-2/h4-5,8-10H,1-3,6-7H2;1H |
| InChIKey | DDJJHJYXZLWNMD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |