methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate

C15H17NO2S — CID 102537570

IUPACmethyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(c2nc3ccccc3s2)CC1
InChIInChI=1S/C15H17NO2S/c1-18-15(17)11-8-6-10(7-9-11)14-16-12-4-2-3-5-13(12)19-14/h2-5,10-11H,6-9H2,1H3
InChIKeyCVYZDUHRDURFJU-UHFFFAOYSA-N
MW275.37 g/mol
LogP3.74
Rot. Bonds2

About methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate

methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 102537570) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate
PubChem CID102537570
Molecular FormulaC15H17NO2S
Molecular Weight275.37 g/mol
Exact Mass275.10
IUPAC Namemethyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(c2nc3ccccc3s2)CC1
InChIInChI=1S/C15H17NO2S/c1-18-15(17)11-8-6-10(7-9-11)14-16-12-4-2-3-5-13(12)19-14/h2-5,10-11H,6-9H2,1H3
InChIKeyCVYZDUHRDURFJU-UHFFFAOYSA-N
XLogP3.74
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.37
LogP ≤ 53.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate (CID 102537570) is methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate is COC(=O)C1CCC(c2nc3ccccc3s2)CC1.
What is the InChIKey of methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate?
The InChIKey is CVYZDUHRDURFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-18-15(17)11-8-6-10(7-9-11)14-16-12-4-2-3-5-13(12)19-14/h2-5,10-11H,6-9H2,1H3.
What are the key properties of methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate?
methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate has a molecular weight of 275.37 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,3-benzothiazol-2-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 102537570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).