C17H23BrN2O2S — CID 169112911
bromomethane;tert-butyl N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]carbamate (PubChem CID 169112911) has the molecular formula C17H23BrN2O2S and a molecular weight of 399.35 g/mol. Its IUPAC name is bromomethane;tert-butyl N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]carbamate.
| Compound Name | bromomethane;tert-butyl N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 169112911 |
| Molecular Formula | C17H23BrN2O2S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | bromomethane;tert-butyl N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]carbamate |
| SMILES | CBr.CC(C)(C)OC(=O)NC1CC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C16H20N2O2S.CH3Br/c1-16(2,3)20-15(19)17-11-8-10(9-11)14-18-12-6-4-5-7-13(12)21-14;1-2/h4-7,10-11H,8-9H2,1-3H3,(H,17,19);1H3 |
| InChIKey | UHFGDHBZZAGFPQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|