C19H21N3O3S — CID 171835697
N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 171835697) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 171835697 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)cyclobutyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CCC1=O)NC1CC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C19H21N3O3S/c23-16(6-3-9-22-17(24)7-8-18(22)25)20-13-10-12(11-13)19-21-14-4-1-2-5-15(14)26-19/h1-2,4-5,12-13H,3,6-11H2,(H,20,23) |
| InChIKey | CWLRGRDMUOAYDM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|