C17H20N2O2S — CID 9235219
1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]pentane-1,4-dione (PubChem CID 9235219) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]pentane-1,4-dione.
| Compound Name | 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 9235219 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCC[C@@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12(20)8-9-16(21)19-10-4-5-13(11-19)17-18-14-6-2-3-7-15(14)22-17/h2-3,6-7,13H,4-5,8-11H2,1H3/t13-/m1/s1 |
| InChIKey | OHBYKSVIVQUHPX-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |