C19H20N4O4S — CID 9341876
1-[2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 9341876) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-[2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9341876 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N2CCC[C@H](c3nc4ccccc4s3)C2)C1=O |
| InChI | InChI=1S/C19H20N4O4S/c1-2-22-17(25)18(26)23(19(22)27)11-15(24)21-9-5-6-12(10-21)16-20-13-7-3-4-8-14(13)28-16/h3-4,7-8,12H,2,5-6,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | CTKOZZCTIHBZAV-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|