C20H20N2O2S — CID 40804818
1-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-phenoxyethanone (PubChem CID 40804818) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 40804818 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C20H20N2O2S/c23-19(14-24-16-8-2-1-3-9-16)22-12-6-7-15(13-22)20-21-17-10-4-5-11-18(17)25-20/h1-5,8-11,15H,6-7,12-14H2/t15-/m0/s1 |
| InChIKey | PEJPHQLAELMFBZ-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |