C18H24N4O2S — CID 9224007
[5-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-5-oxopentyl]urea (PubChem CID 9224007) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is [5-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-5-oxopentyl]urea.
| Compound Name | [5-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-5-oxopentyl]urea |
|---|---|
| PubChem CID | 9224007 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [5-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-5-oxopentyl]urea |
| SMILES | NC(=O)NCCCCC(=O)N1CCC[C@@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C18H24N4O2S/c19-18(24)20-10-4-3-9-16(23)22-11-5-6-13(12-22)17-21-14-7-1-2-8-15(14)25-17/h1-2,7-8,13H,3-6,9-12H2,(H3,19,20,24)/t13-/m1/s1 |
| InChIKey | NBODBGOUJRMRIJ-CYBMUJFWSA-N |
| XLogP | 2.84 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|