C21H23N3O3S — CID 39759523
N-[4-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-4-oxobutyl]furan-2-carboxamide (PubChem CID 39759523) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39759523 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[4-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCC[C@@H](c2nc3ccccc3s2)C1)c1ccco1 |
| InChI | InChI=1S/C21H23N3O3S/c25-19(10-3-11-22-20(26)17-8-5-13-27-17)24-12-4-6-15(14-24)21-23-16-7-1-2-9-18(16)28-21/h1-2,5,7-9,13,15H,3-4,6,10-12,14H2,(H,22,26)/t15-/m1/s1 |
| InChIKey | RRNMNZVTDVKJKS-OAHLLOKOSA-N |
| XLogP | 3.81 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|