C13H18N2O4 — CID 79030088
N-[4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]furan-2-carboxamide (PubChem CID 79030088) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 79030088 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CC[C@H](O)C1)c1ccco1 |
| InChI | InChI=1S/C13H18N2O4/c16-10-5-7-15(9-10)12(17)4-1-6-14-13(18)11-3-2-8-19-11/h2-3,8,10,16H,1,4-7,9H2,(H,14,18)/t10-/m0/s1 |
| InChIKey | BXCNNDGFRYPZKE-JTQLQIEISA-N |
| XLogP | 0.38 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|